C14H20N6O2S2 — CID 18953788
tert-butyl N-[2-[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]ethyl]carbamate (PubChem CID 18953788) has the molecular formula C14H20N6O2S2 and a molecular weight of 368.49 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 18953788 |
| Molecular Formula | C14H20N6O2S2 |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | tert-butyl N-[2-[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1nc(-c2csc(N=C(N)N)n2)cs1 |
| InChI | InChI=1S/C14H20N6O2S2/c1-14(2,3)22-13(21)17-5-4-10-18-8(6-23-10)9-7-24-12(19-9)20-11(15)16/h6-7H,4-5H2,1-3H3,(H,17,21)(H4,15,16,19,20) |
| InChIKey | VLFVYIVIQVUSHR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 128.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|