C15H21N7O3S2 — CID 18953798
tert-butyl N-[2-[[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]methylamino]-2-oxoethyl]carbamate (PubChem CID 18953798) has the molecular formula C15H21N7O3S2 and a molecular weight of 411.51 g/mol. Its IUPAC name is tert-butyl N-[2-[[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]methylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]methylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 18953798 |
| Molecular Formula | C15H21N7O3S2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | tert-butyl N-[2-[[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]methylamino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NCc1nc(-c2csc(N=C(N)N)n2)cs1 |
| InChI | InChI=1S/C15H21N7O3S2/c1-15(2,3)25-14(24)19-4-10(23)18-5-11-20-8(6-26-11)9-7-27-13(21-9)22-12(16)17/h6-7H,4-5H2,1-3H3,(H,18,23)(H,19,24)(H4,16,17,21,22) |
| InChIKey | PVXSTDPIIILZHV-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 157.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|