C10H13N7OS2 — CID 18953803
1-[[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]methyl]-3-methylurea (PubChem CID 18953803) has the molecular formula C10H13N7OS2 and a molecular weight of 311.40 g/mol. Its IUPAC name is 1-[[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]methyl]-3-methylurea.
| Compound Name | 1-[[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]methyl]-3-methylurea |
|---|---|
| PubChem CID | 18953803 |
| Molecular Formula | C10H13N7OS2 |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 1-[[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]methyl]-3-methylurea |
| SMILES | CNC(=O)NCc1nc(-c2csc(N=C(N)N)n2)cs1 |
| InChI | InChI=1S/C10H13N7OS2/c1-13-9(18)14-2-7-15-5(3-19-7)6-4-20-10(16-6)17-8(11)12/h3-4H,2H2,1H3,(H2,13,14,18)(H4,11,12,16,17) |
| InChIKey | ZFNPEPVFGWDEQV-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|