C11H13N9S2 — CID 18953822
1-cyano-3-[[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]methyl]-2-methylguanidine (PubChem CID 18953822) has the molecular formula C11H13N9S2 and a molecular weight of 335.42 g/mol. Its IUPAC name is 1-cyano-3-[[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]methyl]-2-methylguanidine.
| Compound Name | 1-cyano-3-[[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 18953822 |
| Molecular Formula | C11H13N9S2 |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 1-cyano-3-[[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]methyl]-2-methylguanidine |
| SMILES | C/N=C(\NC#N)NCc1nc(-c2csc(N=C(N)N)n2)cs1 |
| InChI | InChI=1S/C11H13N9S2/c1-15-10(17-5-12)16-2-8-18-6(3-21-8)7-4-22-11(19-7)20-9(13)14/h3-4H,2H2,1H3,(H2,15,16,17)(H4,13,14,19,20) |
| InChIKey | GLWQCESSKPQIBR-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 150.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|