C10H11ClN6OS — CID 18953863
6-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]pyridine-2-carboxamide;hydrochloride (PubChem CID 18953863) has the molecular formula C10H11ClN6OS and a molecular weight of 298.76 g/mol. Its IUPAC name is 6-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]pyridine-2-carboxamide;hydrochloride.
| Compound Name | 6-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]pyridine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 18953863 |
| Molecular Formula | C10H11ClN6OS |
| Molecular Weight | 298.76 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 6-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]pyridine-2-carboxamide;hydrochloride |
| SMILES | Cl.NC(=O)c1cccc(-c2csc(N=C(N)N)n2)n1 |
| InChI | InChI=1S/C10H10N6OS.ClH/c11-8(17)6-3-1-2-5(14-6)7-4-18-10(15-7)16-9(12)13;/h1-4H,(H2,11,17)(H4,12,13,15,16);1H |
| InChIKey | LDHZDKGGEPPSCS-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.76 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|