About 2-[4-(6-amino-2-pyridinyl)-1,3-thiazol-2-yl]guanidine;dihydrochloride
2-[4-(6-amino-2-pyridinyl)-1,3-thiazol-2-yl]guanidine;dihydrochloride (PubChem CID 18953872) has the molecular formula C9H12Cl2N6S
and a molecular weight of 307.21 g/mol. Its IUPAC name is 2-[4-(6-amino-2-pyridinyl)-1,3-thiazol-2-yl]guanidine;dihydrochloride.
Molecular Properties
| Compound Name | 2-[4-(6-amino-2-pyridinyl)-1,3-thiazol-2-yl]guanidine;dihydrochloride |
| PubChem CID | 18953872 |
| Molecular Formula | C9H12Cl2N6S |
| Molecular Weight | 307.21 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | 2-[4-(6-amino-2-pyridinyl)-1,3-thiazol-2-yl]guanidine;dihydrochloride |
| SMILES | Cl.Cl.NC(N)=Nc1nc(-c2cccc(N)n2)cs1 |
| InChI | InChI=1S/C9H10N6S.2ClH/c10-7-3-1-2-5(13-7)6-4-16-9(14-6)15-8(11)12;;/h1-4H,(H2,10,13)(H4,11,12,14,15);2*1H |
| InChIKey | LXYAGBAABZNLRV-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.21 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(6-amino-2-pyridinyl)-1,3-thiazol-2-yl]guanidine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(6-amino-2-pyridinyl)-1,3-thiazol-2-yl]guanidine;dihydrochloride?
The IUPAC name of 2-[4-(6-amino-2-pyridinyl)-1,3-thiazol-2-yl]guanidine;dihydrochloride (CID 18953872) is 2-[4-(6-amino-2-pyridinyl)-1,3-thiazol-2-yl]guanidine;dihydrochloride.
What is the SMILES notation for 2-[4-(6-amino-2-pyridinyl)-1,3-thiazol-2-yl]guanidine;dihydrochloride?
The canonical SMILES for 2-[4-(6-amino-2-pyridinyl)-1,3-thiazol-2-yl]guanidine;dihydrochloride is Cl.Cl.NC(N)=Nc1nc(-c2cccc(N)n2)cs1.
What is the InChIKey of 2-[4-(6-amino-2-pyridinyl)-1,3-thiazol-2-yl]guanidine;dihydrochloride?
The InChIKey is LXYAGBAABZNLRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N6S.2ClH/c10-7-3-1-2-5(13-7)6-4-16-9(14-6)15-8(11)12;;/h1-4H,(H2,10,13)(H4,11,12,14,15);2*1H.
What are the key properties of 2-[4-(6-amino-2-pyridinyl)-1,3-thiazol-2-yl]guanidine;dihydrochloride?
2-[4-(6-amino-2-pyridinyl)-1,3-thiazol-2-yl]guanidine;dihydrochloride has a molecular weight of 307.21 g/mol, XLogP of 1.54, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(6-amino-2-pyridinyl)-1,3-thiazol-2-yl]guanidine;dihydrochloride is sourced from PubChem (CID 18953872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).