C9H14Cl2N6S2 — CID 18953926
2-[4-[2-(2-aminoethyl)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]guanidine;dihydrochloride (PubChem CID 18953926) has the molecular formula C9H14Cl2N6S2 and a molecular weight of 341.29 g/mol. Its IUPAC name is 2-[4-[2-(2-aminoethyl)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]guanidine;dihydrochloride.
| Compound Name | 2-[4-[2-(2-aminoethyl)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]guanidine;dihydrochloride |
|---|---|
| PubChem CID | 18953926 |
| Molecular Formula | C9H14Cl2N6S2 |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | 2-[4-[2-(2-aminoethyl)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]guanidine;dihydrochloride |
| SMILES | Cl.Cl.NCCc1nc(-c2csc(N=C(N)N)n2)cs1 |
| InChI | InChI=1S/C9H12N6S2.2ClH/c10-2-1-7-13-5(3-16-7)6-4-17-9(14-6)15-8(11)12;;/h3-4H,1-2,10H2,(H4,11,12,14,15);2*1H |
| InChIKey | GFTGVVLTZAFZNP-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|