C21H24N2O3 — CID 18954705
(E)-4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-phenylbut-2-enoic acid (PubChem CID 18954705) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is (E)-4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-phenylbut-2-enoic acid.
| Compound Name | (E)-4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-phenylbut-2-enoic acid |
|---|---|
| PubChem CID | 18954705 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | (E)-4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-phenylbut-2-enoic acid |
| SMILES | COc1ccccc1N1CCN(C/C(=C/C(=O)O)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H24N2O3/c1-26-20-10-6-5-9-19(20)23-13-11-22(12-14-23)16-18(15-21(24)25)17-7-3-2-4-8-17/h2-10,15H,11-14,16H2,1H3,(H,24,25)/b18-15- |
| InChIKey | WKSHSQFCPGXQJF-SDXDJHTJSA-N |
| XLogP | 2.99 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|