C15H24N4O2S — CID 18954722
3,3-diethyl-5-imidazo[1,2-b]pyridazin-6-ylpentane-1-sulfonamide (PubChem CID 18954722) has the molecular formula C15H24N4O2S and a molecular weight of 324.45 g/mol. Its IUPAC name is 3,3-diethyl-5-imidazo[1,2-b]pyridazin-6-ylpentane-1-sulfonamide.
| Compound Name | 3,3-diethyl-5-imidazo[1,2-b]pyridazin-6-ylpentane-1-sulfonamide |
|---|---|
| PubChem CID | 18954722 |
| Molecular Formula | C15H24N4O2S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 3,3-diethyl-5-imidazo[1,2-b]pyridazin-6-ylpentane-1-sulfonamide |
| SMILES | CCC(CC)(CCc1ccc2nccn2n1)CCS(N)(=O)=O |
| InChI | InChI=1S/C15H24N4O2S/c1-3-15(4-2,9-12-22(16,20)21)8-7-13-5-6-14-17-10-11-19(14)18-13/h5-6,10-11H,3-4,7-9,12H2,1-2H3,(H2,16,20,21) |
| InChIKey | ZKFSDKXNOCPKNS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |