About adamantane;methane
adamantane;methane (PubChem CID 18954917) has the molecular formula C11H20
and a molecular weight of 152.28 g/mol. Its IUPAC name is adamantane;methane.
Molecular Properties
| Compound Name | adamantane;methane |
| PubChem CID | 18954917 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | adamantane;methane |
| SMILES | C.C1C2CC3CC1CC(C2)C3 |
| InChI | InChI=1S/C10H16.CH4/c1-7-2-9-4-8(1)5-10(3-7)6-9;/h7-10H,1-6H2;1H4 |
| InChIKey | BNRMADCKLGLBGH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze adamantane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane;methane?
The IUPAC name of adamantane;methane (CID 18954917) is adamantane;methane.
What is the SMILES notation for adamantane;methane?
The canonical SMILES for adamantane;methane is C.C1C2CC3CC1CC(C2)C3.
What is the InChIKey of adamantane;methane?
The InChIKey is BNRMADCKLGLBGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16.CH4/c1-7-2-9-4-8(1)5-10(3-7)6-9;/h7-10H,1-6H2;1H4.
What are the key properties of adamantane;methane?
adamantane;methane has a molecular weight of 152.28 g/mol, XLogP of 3.47, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane;methane is sourced from PubChem (CID 18954917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).