About 2-(2,3-dihydroimidazo[1,2-b]pyrazol-1-yl)acetamide
2-(2,3-dihydroimidazo[1,2-b]pyrazol-1-yl)acetamide (PubChem CID 18955298) has the molecular formula C7H10N4O
and a molecular weight of 166.18 g/mol. Its IUPAC name is 2-(2,3-dihydroimidazo[1,2-b]pyrazol-1-yl)acetamide.
Molecular Properties
| Compound Name | 2-(2,3-dihydroimidazo[1,2-b]pyrazol-1-yl)acetamide |
| PubChem CID | 18955298 |
| Molecular Formula | C7H10N4O |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 2-(2,3-dihydroimidazo[1,2-b]pyrazol-1-yl)acetamide |
| SMILES | NC(=O)CN1CCn2nccc21 |
| InChI | InChI=1S/C7H10N4O/c8-6(12)5-10-3-4-11-7(10)1-2-9-11/h1-2H,3-5H2,(H2,8,12) |
| InChIKey | BUOKFSOPAKBMEV-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2,3-dihydroimidazo[1,2-b]pyrazol-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dihydroimidazo[1,2-b]pyrazol-1-yl)acetamide?
The IUPAC name of 2-(2,3-dihydroimidazo[1,2-b]pyrazol-1-yl)acetamide (CID 18955298) is 2-(2,3-dihydroimidazo[1,2-b]pyrazol-1-yl)acetamide.
What is the SMILES notation for 2-(2,3-dihydroimidazo[1,2-b]pyrazol-1-yl)acetamide?
The canonical SMILES for 2-(2,3-dihydroimidazo[1,2-b]pyrazol-1-yl)acetamide is NC(=O)CN1CCn2nccc21.
What is the InChIKey of 2-(2,3-dihydroimidazo[1,2-b]pyrazol-1-yl)acetamide?
The InChIKey is BUOKFSOPAKBMEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O/c8-6(12)5-10-3-4-11-7(10)1-2-9-11/h1-2H,3-5H2,(H2,8,12).
What are the key properties of 2-(2,3-dihydroimidazo[1,2-b]pyrazol-1-yl)acetamide?
2-(2,3-dihydroimidazo[1,2-b]pyrazol-1-yl)acetamide has a molecular weight of 166.18 g/mol, XLogP of -0.81, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydroimidazo[1,2-b]pyrazol-1-yl)acetamide is sourced from PubChem (CID 18955298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).