C8H18ClN — CID 18955363
1,3,3-trimethylpiperidine;hydrochloride (PubChem CID 18955363) has the molecular formula C8H18ClN and a molecular weight of 163.69 g/mol. Its IUPAC name is 1,3,3-trimethylpiperidine;hydrochloride.
| Compound Name | 1,3,3-trimethylpiperidine;hydrochloride |
|---|---|
| PubChem CID | 18955363 |
| Molecular Formula | C8H18ClN |
| Molecular Weight | 163.69 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 1,3,3-trimethylpiperidine;hydrochloride |
| SMILES | CN1CCCC(C)(C)C1.Cl |
| InChI | InChI=1S/C8H17N.ClH/c1-8(2)5-4-6-9(3)7-8;/h4-7H2,1-3H3;1H |
| InChIKey | WPEDTKQEOBAGAX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.69 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |