About N,N-dimethyl-1-(oxiran-2-yl)methanamine;2-methylidenebutanedioic acid
N,N-dimethyl-1-(oxiran-2-yl)methanamine;2-methylidenebutanedioic acid (PubChem CID 18955534) has the molecular formula C10H17NO5
and a molecular weight of 231.25 g/mol. Its IUPAC name is N,N-dimethyl-1-(oxiran-2-yl)methanamine;2-methylidenebutanedioic acid.
Molecular Properties
| Compound Name | N,N-dimethyl-1-(oxiran-2-yl)methanamine;2-methylidenebutanedioic acid |
| PubChem CID | 18955534 |
| Molecular Formula | C10H17NO5 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | N,N-dimethyl-1-(oxiran-2-yl)methanamine;2-methylidenebutanedioic acid |
| SMILES | C=C(CC(=O)O)C(=O)O.CN(C)CC1CO1 |
| InChI | InChI=1S/C5H11NO.C5H6O4/c1-6(2)3-5-4-7-5;1-3(5(8)9)2-4(6)7/h5H,3-4H2,1-2H3;1-2H2,(H,6,7)(H,8,9) |
| InChIKey | MVVRDCSTGMIABY-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-1-(oxiran-2-yl)methanamine;2-methylidenebutanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-1-(oxiran-2-yl)methanamine;2-methylidenebutanedioic acid?
The IUPAC name of N,N-dimethyl-1-(oxiran-2-yl)methanamine;2-methylidenebutanedioic acid (CID 18955534) is N,N-dimethyl-1-(oxiran-2-yl)methanamine;2-methylidenebutanedioic acid.
What is the SMILES notation for N,N-dimethyl-1-(oxiran-2-yl)methanamine;2-methylidenebutanedioic acid?
The canonical SMILES for N,N-dimethyl-1-(oxiran-2-yl)methanamine;2-methylidenebutanedioic acid is C=C(CC(=O)O)C(=O)O.CN(C)CC1CO1.
What is the InChIKey of N,N-dimethyl-1-(oxiran-2-yl)methanamine;2-methylidenebutanedioic acid?
The InChIKey is MVVRDCSTGMIABY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO.C5H6O4/c1-6(2)3-5-4-7-5;1-3(5(8)9)2-4(6)7/h5H,3-4H2,1-2H3;1-2H2,(H,6,7)(H,8,9).
What are the key properties of N,N-dimethyl-1-(oxiran-2-yl)methanamine;2-methylidenebutanedioic acid?
N,N-dimethyl-1-(oxiran-2-yl)methanamine;2-methylidenebutanedioic acid has a molecular weight of 231.25 g/mol, XLogP of 0.05, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-1-(oxiran-2-yl)methanamine;2-methylidenebutanedioic acid is sourced from PubChem (CID 18955534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).