C24H54O13 — CID 18955632
cyclohexane-1,2,4-triol;hexane-1,2,3,4-tetrol;hexane-1,2,3-triol;hexane-1,2,4-triol (PubChem CID 18955632) has the molecular formula C24H54O13 and a molecular weight of 550.68 g/mol. Its IUPAC name is cyclohexane-1,2,4-triol;hexane-1,2,3,4-tetrol;hexane-1,2,3-triol;hexane-1,2,4-triol.
| Compound Name | cyclohexane-1,2,4-triol;hexane-1,2,3,4-tetrol;hexane-1,2,3-triol;hexane-1,2,4-triol |
|---|---|
| PubChem CID | 18955632 |
| Molecular Formula | C24H54O13 |
| Molecular Weight | 550.68 g/mol |
| Exact Mass | 550.36 |
| IUPAC Name | cyclohexane-1,2,4-triol;hexane-1,2,3,4-tetrol;hexane-1,2,3-triol;hexane-1,2,4-triol |
| SMILES | CCC(O)C(O)C(O)CO.CCC(O)CC(O)CO.CCCC(O)C(O)CO.OC1CCC(O)C(O)C1 |
| InChI | InChI=1S/C6H14O4.C6H12O3.2C6H14O3/c1-2-4(8)6(10)5(9)3-7;7-4-1-2-5(8)6(9)3-4;1-2-5(8)3-6(9)4-7;1-2-3-5(8)6(9)4-7/h4-10H,2-3H2,1H3;4-9H,1-3H2;2*5-9H,2-4H2,1H3 |
| InChIKey | VVMXXUMQPAZOPU-UHFFFAOYSA-N |
| XLogP | -3.27 |
| TPSA | 262.99 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.68 |
| LogP ≤ 5 | -3.27 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 13 |