C10H21NO2 — CID 18955677
1,2,2,6,6-pentamethylpiperidine-4,4-diol (PubChem CID 18955677) has the molecular formula C10H21NO2 and a molecular weight of 187.28 g/mol. Its IUPAC name is 1,2,2,6,6-pentamethylpiperidine-4,4-diol.
| Compound Name | 1,2,2,6,6-pentamethylpiperidine-4,4-diol |
|---|---|
| PubChem CID | 18955677 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | 1,2,2,6,6-pentamethylpiperidine-4,4-diol |
| SMILES | CN1C(C)(C)CC(O)(O)CC1(C)C |
| InChI | InChI=1S/C10H21NO2/c1-8(2)6-10(12,13)7-9(3,4)11(8)5/h12-13H,6-7H2,1-5H3 |
| InChIKey | IISAYSFDMCDXHM-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|