About ethyl 4-octoxybenzoate
ethyl 4-octoxybenzoate (PubChem CID 18955745) has the molecular formula C17H26O3
and a molecular weight of 278.39 g/mol. Its IUPAC name is ethyl 4-octoxybenzoate.
Molecular Properties
| Compound Name | ethyl 4-octoxybenzoate |
| PubChem CID | 18955745 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | ethyl 4-octoxybenzoate |
| SMILES | CCCCCCCCOc1ccc(C(=O)OCC)cc1 |
| InChI | InChI=1S/C17H26O3/c1-3-5-6-7-8-9-14-20-16-12-10-15(11-13-16)17(18)19-4-2/h10-13H,3-9,14H2,1-2H3 |
| InChIKey | SICLJXQRMTVDED-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-octoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-octoxybenzoate?
The IUPAC name of ethyl 4-octoxybenzoate (CID 18955745) is ethyl 4-octoxybenzoate.
What is the SMILES notation for ethyl 4-octoxybenzoate?
The canonical SMILES for ethyl 4-octoxybenzoate is CCCCCCCCOc1ccc(C(=O)OCC)cc1.
What is the InChIKey of ethyl 4-octoxybenzoate?
The InChIKey is SICLJXQRMTVDED-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O3/c1-3-5-6-7-8-9-14-20-16-12-10-15(11-13-16)17(18)19-4-2/h10-13H,3-9,14H2,1-2H3.
What are the key properties of ethyl 4-octoxybenzoate?
ethyl 4-octoxybenzoate has a molecular weight of 278.39 g/mol, XLogP of 4.60, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-octoxybenzoate is sourced from PubChem (CID 18955745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).