C33H56O4 — CID 18955838
2-decanoyloxy-3,5-bis(2,4,4-trimethylpentan-2-yl)benzoic acid (PubChem CID 18955838) has the molecular formula C33H56O4 and a molecular weight of 516.81 g/mol. Its IUPAC name is 2-decanoyloxy-3,5-bis(2,4,4-trimethylpentan-2-yl)benzoic acid.
| Compound Name | 2-decanoyloxy-3,5-bis(2,4,4-trimethylpentan-2-yl)benzoic acid |
|---|---|
| PubChem CID | 18955838 |
| Molecular Formula | C33H56O4 |
| Molecular Weight | 516.81 g/mol |
| Exact Mass | 516.42 |
| IUPAC Name | 2-decanoyloxy-3,5-bis(2,4,4-trimethylpentan-2-yl)benzoic acid |
| SMILES | CCCCCCCCCC(=O)Oc1c(C(=O)O)cc(C(C)(C)CC(C)(C)C)cc1C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C33H56O4/c1-12-13-14-15-16-17-18-19-27(34)37-28-25(29(35)36)20-24(32(8,9)22-30(2,3)4)21-26(28)33(10,11)23-31(5,6)7/h20-21H,12-19,22-23H2,1-11H3,(H,35,36) |
| InChIKey | VFKLCRWKRLREHG-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.81 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|