C10H6Cl4 — CID 18955868
1,2,4,5-tetrachloro-3,6-bis(ethenyl)benzene (PubChem CID 18955868) has the molecular formula C10H6Cl4 and a molecular weight of 267.97 g/mol. Its IUPAC name is 1,2,4,5-tetrachloro-3,6-bis(ethenyl)benzene.
| Compound Name | 1,2,4,5-tetrachloro-3,6-bis(ethenyl)benzene |
|---|---|
| PubChem CID | 18955868 |
| Molecular Formula | C10H6Cl4 |
| Molecular Weight | 267.97 g/mol |
| Exact Mass | 265.92 |
| IUPAC Name | 1,2,4,5-tetrachloro-3,6-bis(ethenyl)benzene |
| SMILES | C=Cc1c(Cl)c(Cl)c(C=C)c(Cl)c1Cl |
| InChI | InChI=1S/C10H6Cl4/c1-3-5-7(11)9(13)6(4-2)10(14)8(5)12/h3-4H,1-2H2 |
| InChIKey | INMPEUIPFUEEAX-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.97 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|