C36H44N4O3S — CID 18956333
N-[5-[[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]pentyl]-N-heptyl-1,3-benzoxazol-2-amine (PubChem CID 18956333) has the molecular formula C36H44N4O3S and a molecular weight of 612.84 g/mol. Its IUPAC name is N-[5-[[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]pentyl]-N-heptyl-1,3-benzoxazol-2-amine.
| Compound Name | N-[5-[[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]pentyl]-N-heptyl-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 18956333 |
| Molecular Formula | C36H44N4O3S |
| Molecular Weight | 612.84 g/mol |
| Exact Mass | 612.31 |
| IUPAC Name | N-[5-[[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]pentyl]-N-heptyl-1,3-benzoxazol-2-amine |
| SMILES | CCCCCCCN(CCCCCSc1nc(-c2ccc(OC)cc2)c(-c2ccc(OC)cc2)[nH]1)c1nc2ccccc2o1 |
| InChI | InChI=1S/C36H44N4O3S/c1-4-5-6-7-11-24-40(36-37-31-14-9-10-15-32(31)43-36)25-12-8-13-26-44-35-38-33(27-16-20-29(41-2)21-17-27)34(39-35)28-18-22-30(42-3)23-19-28/h9-10,14-23H,4-8,11-13,24-26H2,1-3H3,(H,38,39) |
| InChIKey | GUNPVTZPTBQZGV-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 76.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.84 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|