C12H22O3 — CID 18956485
2-(hydroxymethyl)-2-(4-methylhepta-1,6-dien-4-yl)propane-1,3-diol (PubChem CID 18956485) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is 2-(hydroxymethyl)-2-(4-methylhepta-1,6-dien-4-yl)propane-1,3-diol.
| Compound Name | 2-(hydroxymethyl)-2-(4-methylhepta-1,6-dien-4-yl)propane-1,3-diol |
|---|---|
| PubChem CID | 18956485 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | 2-(hydroxymethyl)-2-(4-methylhepta-1,6-dien-4-yl)propane-1,3-diol |
| SMILES | C=CCC(C)(CC=C)C(CO)(CO)CO |
| InChI | InChI=1S/C12H22O3/c1-4-6-11(3,7-5-2)12(8-13,9-14)10-15/h4-5,13-15H,1-2,6-10H2,3H3 |
| InChIKey | WLSLOUSALZMPKD-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|