About 1-[4-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]-3-fluorophenyl]ethanone
1-[4-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]-3-fluorophenyl]ethanone (PubChem CID 18956592) has the molecular formula C22H16FNO2S
and a molecular weight of 377.44 g/mol. Its IUPAC name is 1-[4-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]-3-fluorophenyl]ethanone.
Molecular Properties
| Compound Name | 1-[4-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]-3-fluorophenyl]ethanone |
| PubChem CID | 18956592 |
| Molecular Formula | C22H16FNO2S |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 1-[4-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]-3-fluorophenyl]ethanone |
| SMILES | CC(=O)c1ccc(-c2ccc(OCc3nc4ccccc4s3)cc2)c(F)c1 |
| InChI | InChI=1S/C22H16FNO2S/c1-14(25)16-8-11-18(19(23)12-16)15-6-9-17(10-7-15)26-13-22-24-20-4-2-3-5-21(20)27-22/h2-12H,13H2,1H3 |
| InChIKey | SHVFUPNFRRYBRS-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]-3-fluorophenyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]-3-fluorophenyl]ethanone?
The IUPAC name of 1-[4-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]-3-fluorophenyl]ethanone (CID 18956592) is 1-[4-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]-3-fluorophenyl]ethanone.
What is the SMILES notation for 1-[4-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]-3-fluorophenyl]ethanone?
The canonical SMILES for 1-[4-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]-3-fluorophenyl]ethanone is CC(=O)c1ccc(-c2ccc(OCc3nc4ccccc4s3)cc2)c(F)c1.
What is the InChIKey of 1-[4-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]-3-fluorophenyl]ethanone?
The InChIKey is SHVFUPNFRRYBRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16FNO2S/c1-14(25)16-8-11-18(19(23)12-16)15-6-9-17(10-7-15)26-13-22-24-20-4-2-3-5-21(20)27-22/h2-12H,13H2,1H3.
What are the key properties of 1-[4-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]-3-fluorophenyl]ethanone?
1-[4-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]-3-fluorophenyl]ethanone has a molecular weight of 377.44 g/mol, XLogP of 5.88, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]-3-fluorophenyl]ethanone is sourced from PubChem (CID 18956592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).