C22H38O7 — CID 18956644
7-(3,3-dibutoxyoxolan-2-yl)-2-methyl-1,5-dioxacycloundecane-6,11-dione (PubChem CID 18956644) has the molecular formula C22H38O7 and a molecular weight of 414.54 g/mol. Its IUPAC name is 7-(3,3-dibutoxyoxolan-2-yl)-2-methyl-1,5-dioxacycloundecane-6,11-dione.
| Compound Name | 7-(3,3-dibutoxyoxolan-2-yl)-2-methyl-1,5-dioxacycloundecane-6,11-dione |
|---|---|
| PubChem CID | 18956644 |
| Molecular Formula | C22H38O7 |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | 7-(3,3-dibutoxyoxolan-2-yl)-2-methyl-1,5-dioxacycloundecane-6,11-dione |
| SMILES | CCCCOC1(OCCCC)CCOC1C1CCCC(=O)OC(C)CCOC1=O |
| InChI | InChI=1S/C22H38O7/c1-4-6-13-27-22(28-14-7-5-2)12-16-25-20(22)18-9-8-10-19(23)29-17(3)11-15-26-21(18)24/h17-18,20H,4-16H2,1-3H3 |
| InChIKey | VZRHOFUOCNGPMH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|