C9H12O9S3 — CID 18956864
4,5,6-tris(methylsulfonyl)benzene-1,2,3-triol (PubChem CID 18956864) has the molecular formula C9H12O9S3 and a molecular weight of 360.39 g/mol. Its IUPAC name is 4,5,6-tris(methylsulfonyl)benzene-1,2,3-triol.
| Compound Name | 4,5,6-tris(methylsulfonyl)benzene-1,2,3-triol |
|---|---|
| PubChem CID | 18956864 |
| Molecular Formula | C9H12O9S3 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 359.96 |
| IUPAC Name | 4,5,6-tris(methylsulfonyl)benzene-1,2,3-triol |
| SMILES | CS(=O)(=O)c1c(O)c(O)c(O)c(S(C)(=O)=O)c1S(C)(=O)=O |
| InChI | InChI=1S/C9H12O9S3/c1-19(13,14)7-5(11)4(10)6(12)8(20(2,15)16)9(7)21(3,17)18/h10-12H,1-3H3 |
| InChIKey | OFADRRNRQUZWHF-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 163.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|