C15H23NO6 — CID 18957253
2,3-dihydroxybutanedioic acid;N,N-dimethyl-1-phenylpropan-1-amine (PubChem CID 18957253) has the molecular formula C15H23NO6 and a molecular weight of 313.35 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;N,N-dimethyl-1-phenylpropan-1-amine.
| Compound Name | 2,3-dihydroxybutanedioic acid;N,N-dimethyl-1-phenylpropan-1-amine |
|---|---|
| PubChem CID | 18957253 |
| Molecular Formula | C15H23NO6 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;N,N-dimethyl-1-phenylpropan-1-amine |
| SMILES | CCC(c1ccccc1)N(C)C.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C11H17N.C4H6O6/c1-4-11(12(2)3)10-8-6-5-7-9-10;5-1(3(7)8)2(6)4(9)10/h5-9,11H,4H2,1-3H3;1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | AVLUFFJONHKIEC-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |