About 2-(hydroxymethyl)-3-propoxybutane-1,4-diol
2-(hydroxymethyl)-3-propoxybutane-1,4-diol (PubChem CID 18957266) has the molecular formula C8H18O4
and a molecular weight of 178.23 g/mol. Its IUPAC name is 2-(hydroxymethyl)-3-propoxybutane-1,4-diol.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)-3-propoxybutane-1,4-diol |
| PubChem CID | 18957266 |
| Molecular Formula | C8H18O4 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 2-(hydroxymethyl)-3-propoxybutane-1,4-diol |
| SMILES | CCCOC(CO)C(CO)CO |
| InChI | InChI=1S/C8H18O4/c1-2-3-12-8(6-11)7(4-9)5-10/h7-11H,2-6H2,1H3 |
| InChIKey | BPJGYOCSWUULFS-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(hydroxymethyl)-3-propoxybutane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)-3-propoxybutane-1,4-diol?
The IUPAC name of 2-(hydroxymethyl)-3-propoxybutane-1,4-diol (CID 18957266) is 2-(hydroxymethyl)-3-propoxybutane-1,4-diol.
What is the SMILES notation for 2-(hydroxymethyl)-3-propoxybutane-1,4-diol?
The canonical SMILES for 2-(hydroxymethyl)-3-propoxybutane-1,4-diol is CCCOC(CO)C(CO)CO.
What is the InChIKey of 2-(hydroxymethyl)-3-propoxybutane-1,4-diol?
The InChIKey is BPJGYOCSWUULFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O4/c1-2-3-12-8(6-11)7(4-9)5-10/h7-11H,2-6H2,1H3.
What are the key properties of 2-(hydroxymethyl)-3-propoxybutane-1,4-diol?
2-(hydroxymethyl)-3-propoxybutane-1,4-diol has a molecular weight of 178.23 g/mol, XLogP of -0.63, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)-3-propoxybutane-1,4-diol is sourced from PubChem (CID 18957266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).