C6H15N3O2 — CID 18957268
1,3-dimethylurea;N-methylacetamide (PubChem CID 18957268) has the molecular formula C6H15N3O2 and a molecular weight of 161.20 g/mol. Its IUPAC name is 1,3-dimethylurea;N-methylacetamide.
| Compound Name | 1,3-dimethylurea;N-methylacetamide |
|---|---|
| PubChem CID | 18957268 |
| Molecular Formula | C6H15N3O2 |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 1,3-dimethylurea;N-methylacetamide |
| SMILES | CNC(=O)NC.CNC(C)=O |
| InChI | InChI=1S/C3H8N2O.C3H7NO/c1-4-3(6)5-2;1-3(5)4-2/h1-2H3,(H2,4,5,6);1-2H3,(H,4,5) |
| InChIKey | NVTSEKRKTWIPLF-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |