About 3,3-diethylazocane
3,3-diethylazocane (PubChem CID 18957809) has the molecular formula C11H23N
and a molecular weight of 169.31 g/mol. Its IUPAC name is 3,3-diethylazocane.
Molecular Properties
| Compound Name | 3,3-diethylazocane |
| PubChem CID | 18957809 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | 3,3-diethylazocane |
| SMILES | CCC1(CC)CCCCCNC1 |
| InChI | InChI=1S/C11H23N/c1-3-11(4-2)8-6-5-7-9-12-10-11/h12H,3-10H2,1-2H3 |
| InChIKey | OVTCENNJUBJEGX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,3-diethylazocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-diethylazocane?
The IUPAC name of 3,3-diethylazocane (CID 18957809) is 3,3-diethylazocane.
What is the SMILES notation for 3,3-diethylazocane?
The canonical SMILES for 3,3-diethylazocane is CCC1(CC)CCCCCNC1.
What is the InChIKey of 3,3-diethylazocane?
The InChIKey is OVTCENNJUBJEGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N/c1-3-11(4-2)8-6-5-7-9-12-10-11/h12H,3-10H2,1-2H3.
What are the key properties of 3,3-diethylazocane?
3,3-diethylazocane has a molecular weight of 169.31 g/mol, XLogP of 2.96, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-diethylazocane is sourced from PubChem (CID 18957809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).