C13H13N3O3 — CID 18957949
5-benzyl-1-oxido-7,8-dihydro-6H-[1,2,5]oxadiazolo[3,4-c]azepin-1-ium-4-one (PubChem CID 18957949) has the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. Its IUPAC name is 5-benzyl-1-oxido-7,8-dihydro-6H-[1,2,5]oxadiazolo[3,4-c]azepin-1-ium-4-one.
| Compound Name | 5-benzyl-1-oxido-7,8-dihydro-6H-[1,2,5]oxadiazolo[3,4-c]azepin-1-ium-4-one |
|---|---|
| PubChem CID | 18957949 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 5-benzyl-1-oxido-7,8-dihydro-6H-[1,2,5]oxadiazolo[3,4-c]azepin-1-ium-4-one |
| SMILES | O=C1c2no[n+]([O-])c2CCCN1Cc1ccccc1 |
| InChI | InChI=1S/C13H13N3O3/c17-13-12-11(16(18)19-14-12)7-4-8-15(13)9-10-5-2-1-3-6-10/h1-3,5-6H,4,7-9H2 |
| InChIKey | IYEIEDAOAWHVTP-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 73.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|