C7H10O3 — CID 18958031
5-methyl-6,8-dioxabicyclo[3.2.1]octan-3-one (PubChem CID 18958031) has the molecular formula C7H10O3 and a molecular weight of 142.15 g/mol. Its IUPAC name is 5-methyl-6,8-dioxabicyclo[3.2.1]octan-3-one.
| Compound Name | 5-methyl-6,8-dioxabicyclo[3.2.1]octan-3-one |
|---|---|
| PubChem CID | 18958031 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | 5-methyl-6,8-dioxabicyclo[3.2.1]octan-3-one |
| SMILES | CC12CC(=O)CC(CO1)O2 |
| InChI | InChI=1S/C7H10O3/c1-7-3-5(8)2-6(10-7)4-9-7/h6H,2-4H2,1H3 |
| InChIKey | IGOICPWGOURETL-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |