About 5-methyl-6,8-dioxabicyclo[3.2.1]octan-3-one
5-methyl-6,8-dioxabicyclo[3.2.1]octan-3-one (PubChem CID 18958031) has the molecular formula C7H10O3
and a molecular weight of 142.15 g/mol. Its IUPAC name is 5-methyl-6,8-dioxabicyclo[3.2.1]octan-3-one.
Molecular Properties
| Compound Name | 5-methyl-6,8-dioxabicyclo[3.2.1]octan-3-one |
| PubChem CID | 18958031 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | 5-methyl-6,8-dioxabicyclo[3.2.1]octan-3-one |
| SMILES | CC12CC(=O)CC(CO1)O2 |
| InChI | InChI=1S/C7H10O3/c1-7-3-5(8)2-6(10-7)4-9-7/h6H,2-4H2,1H3 |
| InChIKey | IGOICPWGOURETL-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-6,8-dioxabicyclo[3.2.1]octan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-6,8-dioxabicyclo[3.2.1]octan-3-one?
The IUPAC name of 5-methyl-6,8-dioxabicyclo[3.2.1]octan-3-one (CID 18958031) is 5-methyl-6,8-dioxabicyclo[3.2.1]octan-3-one.
What is the SMILES notation for 5-methyl-6,8-dioxabicyclo[3.2.1]octan-3-one?
The canonical SMILES for 5-methyl-6,8-dioxabicyclo[3.2.1]octan-3-one is CC12CC(=O)CC(CO1)O2.
What is the InChIKey of 5-methyl-6,8-dioxabicyclo[3.2.1]octan-3-one?
The InChIKey is IGOICPWGOURETL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3/c1-7-3-5(8)2-6(10-7)4-9-7/h6H,2-4H2,1H3.
What are the key properties of 5-methyl-6,8-dioxabicyclo[3.2.1]octan-3-one?
5-methyl-6,8-dioxabicyclo[3.2.1]octan-3-one has a molecular weight of 142.15 g/mol, XLogP of 0.48, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-6,8-dioxabicyclo[3.2.1]octan-3-one is sourced from PubChem (CID 18958031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).