About chloro-tri(cyclopenta-1,3-dien-1-yl)silane
chloro-tri(cyclopenta-1,3-dien-1-yl)silane (PubChem CID 18958364) has the molecular formula C15H15ClSi
and a molecular weight of 258.82 g/mol. Its IUPAC name is chloro-tri(cyclopenta-1,3-dien-1-yl)silane.
Molecular Properties
| Compound Name | chloro-tri(cyclopenta-1,3-dien-1-yl)silane |
| PubChem CID | 18958364 |
| Molecular Formula | C15H15ClSi |
| Molecular Weight | 258.82 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | chloro-tri(cyclopenta-1,3-dien-1-yl)silane |
| SMILES | Cl[Si](C1=CC=CC1)(C1=CC=CC1)C1=CC=CC1 |
| InChI | InChI=1S/C15H15ClSi/c16-17(13-7-1-2-8-13,14-9-3-4-10-14)15-11-5-6-12-15/h1-7,9,11H,8,10,12H2 |
| InChIKey | SLSPFUPCWGTADQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.82 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze chloro-tri(cyclopenta-1,3-dien-1-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-tri(cyclopenta-1,3-dien-1-yl)silane?
The IUPAC name of chloro-tri(cyclopenta-1,3-dien-1-yl)silane (CID 18958364) is chloro-tri(cyclopenta-1,3-dien-1-yl)silane.
What is the SMILES notation for chloro-tri(cyclopenta-1,3-dien-1-yl)silane?
The canonical SMILES for chloro-tri(cyclopenta-1,3-dien-1-yl)silane is Cl[Si](C1=CC=CC1)(C1=CC=CC1)C1=CC=CC1.
What is the InChIKey of chloro-tri(cyclopenta-1,3-dien-1-yl)silane?
The InChIKey is SLSPFUPCWGTADQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15ClSi/c16-17(13-7-1-2-8-13,14-9-3-4-10-14)15-11-5-6-12-15/h1-7,9,11H,8,10,12H2.
What are the key properties of chloro-tri(cyclopenta-1,3-dien-1-yl)silane?
chloro-tri(cyclopenta-1,3-dien-1-yl)silane has a molecular weight of 258.82 g/mol, XLogP of 4.45, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-tri(cyclopenta-1,3-dien-1-yl)silane is sourced from PubChem (CID 18958364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).