About CID 18958372
CID 18958372 (PubChem CID 18958372) has the molecular formula C21H18ClSi
and a molecular weight of 333.91 g/mol.
Molecular Properties
| Compound Name | CID 18958372 |
| PubChem CID | 18958372 |
| Molecular Formula | C21H18ClSi |
| Molecular Weight | 333.91 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | — |
| SMILES | CC1=Cc2ccccc2C1C([Si])(Cl)C1C(C)=Cc2ccccc21 |
| InChI | InChI=1S/C21H18ClSi/c1-13-11-15-7-3-5-9-17(15)19(13)21(22,23)20-14(2)12-16-8-4-6-10-18(16)20/h3-12,19-20H,1-2H3 |
| InChIKey | RXDVSLCCYFCTRN-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.91 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 18958372 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 18958372?
The IUPAC name of CID 18958372 (CID 18958372) is not available.
What is the SMILES notation for CID 18958372?
The canonical SMILES for CID 18958372 is CC1=Cc2ccccc2C1C([Si])(Cl)C1C(C)=Cc2ccccc21.
What is the InChIKey of CID 18958372?
The InChIKey is RXDVSLCCYFCTRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18ClSi/c1-13-11-15-7-3-5-9-17(15)19(13)21(22,23)20-14(2)12-16-8-4-6-10-18(16)20/h3-12,19-20H,1-2H3.
What are the key properties of CID 18958372?
CID 18958372 has a molecular weight of 333.91 g/mol, XLogP of 5.49, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 18958372 is sourced from PubChem (CID 18958372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).