About 4-[anilino-[4-hydroxy-3,5-di(propan-2-yl)phenyl]methyl]-2,6-di(propan-2-yl)phenol
4-[anilino-[4-hydroxy-3,5-di(propan-2-yl)phenyl]methyl]-2,6-di(propan-2-yl)phenol (PubChem CID 18958482) has the molecular formula C31H41NO2
and a molecular weight of 459.67 g/mol. Its IUPAC name is 4-[anilino-[4-hydroxy-3,5-di(propan-2-yl)phenyl]methyl]-2,6-di(propan-2-yl)phenol.
Molecular Properties
| Compound Name | 4-[anilino-[4-hydroxy-3,5-di(propan-2-yl)phenyl]methyl]-2,6-di(propan-2-yl)phenol |
| PubChem CID | 18958482 |
| Molecular Formula | C31H41NO2 |
| Molecular Weight | 459.67 g/mol |
| Exact Mass | 459.31 |
| IUPAC Name | 4-[anilino-[4-hydroxy-3,5-di(propan-2-yl)phenyl]methyl]-2,6-di(propan-2-yl)phenol |
| SMILES | CC(C)c1cc(C(Nc2ccccc2)c2cc(C(C)C)c(O)c(C(C)C)c2)cc(C(C)C)c1O |
| InChI | InChI=1S/C31H41NO2/c1-18(2)25-14-22(15-26(19(3)4)30(25)33)29(32-24-12-10-9-11-13-24)23-16-27(20(5)6)31(34)28(17-23)21(7)8/h9-21,29,32-34H,1-8H3 |
| InChIKey | FJVLUIGPXSJWJR-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.67 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[anilino-[4-hydroxy-3,5-di(propan-2-yl)phenyl]methyl]-2,6-di(propan-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[anilino-[4-hydroxy-3,5-di(propan-2-yl)phenyl]methyl]-2,6-di(propan-2-yl)phenol?
The IUPAC name of 4-[anilino-[4-hydroxy-3,5-di(propan-2-yl)phenyl]methyl]-2,6-di(propan-2-yl)phenol (CID 18958482) is 4-[anilino-[4-hydroxy-3,5-di(propan-2-yl)phenyl]methyl]-2,6-di(propan-2-yl)phenol.
What is the SMILES notation for 4-[anilino-[4-hydroxy-3,5-di(propan-2-yl)phenyl]methyl]-2,6-di(propan-2-yl)phenol?
The canonical SMILES for 4-[anilino-[4-hydroxy-3,5-di(propan-2-yl)phenyl]methyl]-2,6-di(propan-2-yl)phenol is CC(C)c1cc(C(Nc2ccccc2)c2cc(C(C)C)c(O)c(C(C)C)c2)cc(C(C)C)c1O.
What is the InChIKey of 4-[anilino-[4-hydroxy-3,5-di(propan-2-yl)phenyl]methyl]-2,6-di(propan-2-yl)phenol?
The InChIKey is FJVLUIGPXSJWJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H41NO2/c1-18(2)25-14-22(15-26(19(3)4)30(25)33)29(32-24-12-10-9-11-13-24)23-16-27(20(5)6)31(34)28(17-23)21(7)8/h9-21,29,32-34H,1-8H3.
What are the key properties of 4-[anilino-[4-hydroxy-3,5-di(propan-2-yl)phenyl]methyl]-2,6-di(propan-2-yl)phenol?
4-[anilino-[4-hydroxy-3,5-di(propan-2-yl)phenyl]methyl]-2,6-di(propan-2-yl)phenol has a molecular weight of 459.67 g/mol, XLogP of 8.79, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[anilino-[4-hydroxy-3,5-di(propan-2-yl)phenyl]methyl]-2,6-di(propan-2-yl)phenol is sourced from PubChem (CID 18958482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).