C12H20N4O2 — CID 18958567
2,5,8,11-tetrazabicyclo[10.4.0]hexadec-14-ene-4,9-dione (PubChem CID 18958567) has the molecular formula C12H20N4O2 and a molecular weight of 252.32 g/mol. Its IUPAC name is 2,5,8,11-tetrazabicyclo[10.4.0]hexadec-14-ene-4,9-dione.
| Compound Name | 2,5,8,11-tetrazabicyclo[10.4.0]hexadec-14-ene-4,9-dione |
|---|---|
| PubChem CID | 18958567 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 2,5,8,11-tetrazabicyclo[10.4.0]hexadec-14-ene-4,9-dione |
| SMILES | O=C1CNC2CC=CCC2NCC(=O)NCCN1 |
| InChI | InChI=1S/C12H20N4O2/c17-11-7-15-9-3-1-2-4-10(9)16-8-12(18)14-6-5-13-11/h1-2,9-10,15-16H,3-8H2,(H,13,17)(H,14,18) |
| InChIKey | LFKPNHZFFDASFO-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|