C16H26N4O2 — CID 18958573
2,5,12,15-tetrazatricyclo[14.4.0.06,11]icos-8-ene-3,14-dione (PubChem CID 18958573) has the molecular formula C16H26N4O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 2,5,12,15-tetrazatricyclo[14.4.0.06,11]icos-8-ene-3,14-dione.
| Compound Name | 2,5,12,15-tetrazatricyclo[14.4.0.06,11]icos-8-ene-3,14-dione |
|---|---|
| PubChem CID | 18958573 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 2,5,12,15-tetrazatricyclo[14.4.0.06,11]icos-8-ene-3,14-dione |
| SMILES | O=C1CNC2CC=CCC2NCC(=O)NC2CCCCC2N1 |
| InChI | InChI=1S/C16H26N4O2/c21-15-9-17-11-5-1-2-6-12(11)18-10-16(22)20-14-8-4-3-7-13(14)19-15/h1-2,11-14,17-18H,3-10H2,(H,19,21)(H,20,22) |
| InChIKey | TVJSBHNHIPHAEW-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|