About 4-bromo-3-methylpyridine;hydrochloride
4-bromo-3-methylpyridine;hydrochloride (PubChem CID 18958774) has the molecular formula C6H7BrClN
and a molecular weight of 208.49 g/mol. Its IUPAC name is 4-bromo-3-methylpyridine;hydrochloride.
Molecular Properties
| Compound Name | 4-bromo-3-methylpyridine;hydrochloride |
| PubChem CID | 18958774 |
| Molecular Formula | C6H7BrClN |
| Molecular Weight | 208.49 g/mol |
| Exact Mass | 206.95 |
| IUPAC Name | 4-bromo-3-methylpyridine;hydrochloride |
| SMILES | Cc1cnccc1Br.Cl |
| InChI | InChI=1S/C6H6BrN.ClH/c1-5-4-8-3-2-6(5)7;/h2-4H,1H3;1H |
| InChIKey | KQFBHVJLZVHFFX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.49 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-bromo-3-methylpyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3-methylpyridine;hydrochloride?
The IUPAC name of 4-bromo-3-methylpyridine;hydrochloride (CID 18958774) is 4-bromo-3-methylpyridine;hydrochloride.
What is the SMILES notation for 4-bromo-3-methylpyridine;hydrochloride?
The canonical SMILES for 4-bromo-3-methylpyridine;hydrochloride is Cc1cnccc1Br.Cl.
What is the InChIKey of 4-bromo-3-methylpyridine;hydrochloride?
The InChIKey is KQFBHVJLZVHFFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BrN.ClH/c1-5-4-8-3-2-6(5)7;/h2-4H,1H3;1H.
What are the key properties of 4-bromo-3-methylpyridine;hydrochloride?
4-bromo-3-methylpyridine;hydrochloride has a molecular weight of 208.49 g/mol, XLogP of 2.57, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3-methylpyridine;hydrochloride is sourced from PubChem (CID 18958774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).