About pyrido[2,1-a][2]benzazepine
pyrido[2,1-a][2]benzazepine (PubChem CID 18958943) has the molecular formula C14H11N
and a molecular weight of 193.25 g/mol. Its IUPAC name is pyrido[2,1-a][2]benzazepine.
Molecular Properties
| Compound Name | pyrido[2,1-a][2]benzazepine |
| PubChem CID | 18958943 |
| Molecular Formula | C14H11N |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | pyrido[2,1-a][2]benzazepine |
| SMILES | C1=CC2=c3ccccc3=CC=CN2C=C1 |
| InChI | InChI=1S/C14H11N/c1-2-8-13-12(6-1)7-5-11-15-10-4-3-9-14(13)15/h1-11H |
| InChIKey | XUHCUMBEJNBVHE-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze pyrido[2,1-a][2]benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrido[2,1-a][2]benzazepine?
The IUPAC name of pyrido[2,1-a][2]benzazepine (CID 18958943) is pyrido[2,1-a][2]benzazepine.
What is the SMILES notation for pyrido[2,1-a][2]benzazepine?
The canonical SMILES for pyrido[2,1-a][2]benzazepine is C1=CC2=c3ccccc3=CC=CN2C=C1.
What is the InChIKey of pyrido[2,1-a][2]benzazepine?
The InChIKey is XUHCUMBEJNBVHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N/c1-2-8-13-12(6-1)7-5-11-15-10-4-3-9-14(13)15/h1-11H.
What are the key properties of pyrido[2,1-a][2]benzazepine?
pyrido[2,1-a][2]benzazepine has a molecular weight of 193.25 g/mol, XLogP of 1.49, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pyrido[2,1-a][2]benzazepine is sourced from PubChem (CID 18958943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).