C16H32Cl2OSi — CID 18959108
2,2-dichloro-5,5,6,6-tetra(propan-2-yl)oxasilinane (PubChem CID 18959108) has the molecular formula C16H32Cl2OSi and a molecular weight of 339.42 g/mol. Its IUPAC name is 2,2-dichloro-5,5,6,6-tetra(propan-2-yl)oxasilinane.
| Compound Name | 2,2-dichloro-5,5,6,6-tetra(propan-2-yl)oxasilinane |
|---|---|
| PubChem CID | 18959108 |
| Molecular Formula | C16H32Cl2OSi |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 2,2-dichloro-5,5,6,6-tetra(propan-2-yl)oxasilinane |
| SMILES | CC(C)C1(C(C)C)CC[Si](Cl)(Cl)OC1(C(C)C)C(C)C |
| InChI | InChI=1S/C16H32Cl2OSi/c1-11(2)15(12(3)4)9-10-20(17,18)19-16(15,13(5)6)14(7)8/h11-14H,9-10H2,1-8H3 |
| InChIKey | ZQEZHIMJGPMGOI-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|