About (E)-N',N'-bis(2-aminoacetyl)-N,N-diethylbut-2-enediamide
(E)-N',N'-bis(2-aminoacetyl)-N,N-diethylbut-2-enediamide (PubChem CID 18959792) has the molecular formula C12H20N4O4
and a molecular weight of 284.32 g/mol. Its IUPAC name is (E)-N',N'-bis(2-aminoacetyl)-N,N-diethylbut-2-enediamide.
Molecular Properties
| Compound Name | (E)-N',N'-bis(2-aminoacetyl)-N,N-diethylbut-2-enediamide |
| PubChem CID | 18959792 |
| Molecular Formula | C12H20N4O4 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | (E)-N',N'-bis(2-aminoacetyl)-N,N-diethylbut-2-enediamide |
| SMILES | CCN(CC)C(=O)/C=C/C(=O)N(C(=O)CN)C(=O)CN |
| InChI | InChI=1S/C12H20N4O4/c1-3-15(4-2)9(17)5-6-10(18)16(11(19)7-13)12(20)8-14/h5-6H,3-4,7-8,13-14H2,1-2H3/b6-5+ |
| InChIKey | ONSKHPWDLDTGBH-AATRIKPKSA-N |
| XLogP | -1.79 |
| TPSA | 126.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N',N'-bis(2-aminoacetyl)-N,N-diethylbut-2-enediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N',N'-bis(2-aminoacetyl)-N,N-diethylbut-2-enediamide?
The IUPAC name of (E)-N',N'-bis(2-aminoacetyl)-N,N-diethylbut-2-enediamide (CID 18959792) is (E)-N',N'-bis(2-aminoacetyl)-N,N-diethylbut-2-enediamide.
What is the SMILES notation for (E)-N',N'-bis(2-aminoacetyl)-N,N-diethylbut-2-enediamide?
The canonical SMILES for (E)-N',N'-bis(2-aminoacetyl)-N,N-diethylbut-2-enediamide is CCN(CC)C(=O)/C=C/C(=O)N(C(=O)CN)C(=O)CN.
What is the InChIKey of (E)-N',N'-bis(2-aminoacetyl)-N,N-diethylbut-2-enediamide?
The InChIKey is ONSKHPWDLDTGBH-AATRIKPKSA-N. The full InChI is InChI=1S/C12H20N4O4/c1-3-15(4-2)9(17)5-6-10(18)16(11(19)7-13)12(20)8-14/h5-6H,3-4,7-8,13-14H2,1-2H3/b6-5+.
What are the key properties of (E)-N',N'-bis(2-aminoacetyl)-N,N-diethylbut-2-enediamide?
(E)-N',N'-bis(2-aminoacetyl)-N,N-diethylbut-2-enediamide has a molecular weight of 284.32 g/mol, XLogP of -1.79, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N',N'-bis(2-aminoacetyl)-N,N-diethylbut-2-enediamide is sourced from PubChem (CID 18959792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).