About 4-amino-2,6-dicyclohexylphenol
4-amino-2,6-dicyclohexylphenol (PubChem CID 18959879) has the molecular formula C18H27NO
and a molecular weight of 273.42 g/mol. Its IUPAC name is 4-amino-2,6-dicyclohexylphenol.
Molecular Properties
| Compound Name | 4-amino-2,6-dicyclohexylphenol |
| PubChem CID | 18959879 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | 4-amino-2,6-dicyclohexylphenol |
| SMILES | Nc1cc(C2CCCCC2)c(O)c(C2CCCCC2)c1 |
| InChI | InChI=1S/C18H27NO/c19-15-11-16(13-7-3-1-4-8-13)18(20)17(12-15)14-9-5-2-6-10-14/h11-14,20H,1-10,19H2 |
| InChIKey | RJNKBVUMDYIDBS-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2,6-dicyclohexylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2,6-dicyclohexylphenol?
The IUPAC name of 4-amino-2,6-dicyclohexylphenol (CID 18959879) is 4-amino-2,6-dicyclohexylphenol.
What is the SMILES notation for 4-amino-2,6-dicyclohexylphenol?
The canonical SMILES for 4-amino-2,6-dicyclohexylphenol is Nc1cc(C2CCCCC2)c(O)c(C2CCCCC2)c1.
What is the InChIKey of 4-amino-2,6-dicyclohexylphenol?
The InChIKey is RJNKBVUMDYIDBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27NO/c19-15-11-16(13-7-3-1-4-8-13)18(20)17(12-15)14-9-5-2-6-10-14/h11-14,20H,1-10,19H2.
What are the key properties of 4-amino-2,6-dicyclohexylphenol?
4-amino-2,6-dicyclohexylphenol has a molecular weight of 273.42 g/mol, XLogP of 5.07, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2,6-dicyclohexylphenol is sourced from PubChem (CID 18959879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).