About [4-[4-[4-(2-fluorooctanoyloxy)cyclohexyl]phenyl]cyclohexyl] 2-fluorooctanoate
[4-[4-[4-(2-fluorooctanoyloxy)cyclohexyl]phenyl]cyclohexyl] 2-fluorooctanoate (PubChem CID 18960158) has the molecular formula C34H52F2O4
and a molecular weight of 562.78 g/mol. Its IUPAC name is [4-[4-[4-(2-fluorooctanoyloxy)cyclohexyl]phenyl]cyclohexyl] 2-fluorooctanoate.
Molecular Properties
| Compound Name | [4-[4-[4-(2-fluorooctanoyloxy)cyclohexyl]phenyl]cyclohexyl] 2-fluorooctanoate |
| PubChem CID | 18960158 |
| Molecular Formula | C34H52F2O4 |
| Molecular Weight | 562.78 g/mol |
| Exact Mass | 562.38 |
| IUPAC Name | [4-[4-[4-(2-fluorooctanoyloxy)cyclohexyl]phenyl]cyclohexyl] 2-fluorooctanoate |
| SMILES | CCCCCCC(F)C(=O)OC1CCC(c2ccc(C3CCC(OC(=O)C(F)CCCCCC)CC3)cc2)CC1 |
| InChI | InChI=1S/C34H52F2O4/c1-3-5-7-9-11-31(35)33(37)39-29-21-17-27(18-22-29)25-13-15-26(16-14-25)28-19-23-30(24-20-28)40-34(38)32(36)12-10-8-6-4-2/h13-16,27-32H,3-12,17-24H2,1-2H3 |
| InChIKey | LPOHTJCVQFMOHF-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 562.78 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [4-[4-[4-(2-fluorooctanoyloxy)cyclohexyl]phenyl]cyclohexyl] 2-fluorooctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-[4-(2-fluorooctanoyloxy)cyclohexyl]phenyl]cyclohexyl] 2-fluorooctanoate?
The IUPAC name of [4-[4-[4-(2-fluorooctanoyloxy)cyclohexyl]phenyl]cyclohexyl] 2-fluorooctanoate (CID 18960158) is [4-[4-[4-(2-fluorooctanoyloxy)cyclohexyl]phenyl]cyclohexyl] 2-fluorooctanoate.
What is the SMILES notation for [4-[4-[4-(2-fluorooctanoyloxy)cyclohexyl]phenyl]cyclohexyl] 2-fluorooctanoate?
The canonical SMILES for [4-[4-[4-(2-fluorooctanoyloxy)cyclohexyl]phenyl]cyclohexyl] 2-fluorooctanoate is CCCCCCC(F)C(=O)OC1CCC(c2ccc(C3CCC(OC(=O)C(F)CCCCCC)CC3)cc2)CC1.
What is the InChIKey of [4-[4-[4-(2-fluorooctanoyloxy)cyclohexyl]phenyl]cyclohexyl] 2-fluorooctanoate?
The InChIKey is LPOHTJCVQFMOHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H52F2O4/c1-3-5-7-9-11-31(35)33(37)39-29-21-17-27(18-22-29)25-13-15-26(16-14-25)28-19-23-30(24-20-28)40-34(38)32(36)12-10-8-6-4-2/h13-16,27-32H,3-12,17-24H2,1-2H3.
What are the key properties of [4-[4-[4-(2-fluorooctanoyloxy)cyclohexyl]phenyl]cyclohexyl] 2-fluorooctanoate?
[4-[4-[4-(2-fluorooctanoyloxy)cyclohexyl]phenyl]cyclohexyl] 2-fluorooctanoate has a molecular weight of 562.78 g/mol, XLogP of 9.44, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-[4-(2-fluorooctanoyloxy)cyclohexyl]phenyl]cyclohexyl] 2-fluorooctanoate is sourced from PubChem (CID 18960158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).