About [4-[3-fluoro-4-[4-(2-fluoroheptanoyloxy)cyclohexyl]phenyl]cyclohexyl] 2-fluoroheptanoate
[4-[3-fluoro-4-[4-(2-fluoroheptanoyloxy)cyclohexyl]phenyl]cyclohexyl] 2-fluoroheptanoate (PubChem CID 18960164) has the molecular formula C32H47F3O4
and a molecular weight of 552.72 g/mol. Its IUPAC name is [4-[3-fluoro-4-[4-(2-fluoroheptanoyloxy)cyclohexyl]phenyl]cyclohexyl] 2-fluoroheptanoate.
Molecular Properties
| Compound Name | [4-[3-fluoro-4-[4-(2-fluoroheptanoyloxy)cyclohexyl]phenyl]cyclohexyl] 2-fluoroheptanoate |
| PubChem CID | 18960164 |
| Molecular Formula | C32H47F3O4 |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 552.34 |
| IUPAC Name | [4-[3-fluoro-4-[4-(2-fluoroheptanoyloxy)cyclohexyl]phenyl]cyclohexyl] 2-fluoroheptanoate |
| SMILES | CCCCCC(F)C(=O)OC1CCC(c2ccc(C3CCC(OC(=O)C(F)CCCCC)CC3)c(F)c2)CC1 |
| InChI | InChI=1S/C32H47F3O4/c1-3-5-7-9-28(33)31(36)38-25-16-11-22(12-17-25)24-15-20-27(30(35)21-24)23-13-18-26(19-14-23)39-32(37)29(34)10-8-6-4-2/h15,20-23,25-26,28-29H,3-14,16-19H2,1-2H3 |
| InChIKey | RKYUJZOYJGLVTO-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [4-[3-fluoro-4-[4-(2-fluoroheptanoyloxy)cyclohexyl]phenyl]cyclohexyl] 2-fluoroheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[3-fluoro-4-[4-(2-fluoroheptanoyloxy)cyclohexyl]phenyl]cyclohexyl] 2-fluoroheptanoate?
The IUPAC name of [4-[3-fluoro-4-[4-(2-fluoroheptanoyloxy)cyclohexyl]phenyl]cyclohexyl] 2-fluoroheptanoate (CID 18960164) is [4-[3-fluoro-4-[4-(2-fluoroheptanoyloxy)cyclohexyl]phenyl]cyclohexyl] 2-fluoroheptanoate.
What is the SMILES notation for [4-[3-fluoro-4-[4-(2-fluoroheptanoyloxy)cyclohexyl]phenyl]cyclohexyl] 2-fluoroheptanoate?
The canonical SMILES for [4-[3-fluoro-4-[4-(2-fluoroheptanoyloxy)cyclohexyl]phenyl]cyclohexyl] 2-fluoroheptanoate is CCCCCC(F)C(=O)OC1CCC(c2ccc(C3CCC(OC(=O)C(F)CCCCC)CC3)c(F)c2)CC1.
What is the InChIKey of [4-[3-fluoro-4-[4-(2-fluoroheptanoyloxy)cyclohexyl]phenyl]cyclohexyl] 2-fluoroheptanoate?
The InChIKey is RKYUJZOYJGLVTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H47F3O4/c1-3-5-7-9-28(33)31(36)38-25-16-11-22(12-17-25)24-15-20-27(30(35)21-24)23-13-18-26(19-14-23)39-32(37)29(34)10-8-6-4-2/h15,20-23,25-26,28-29H,3-14,16-19H2,1-2H3.
What are the key properties of [4-[3-fluoro-4-[4-(2-fluoroheptanoyloxy)cyclohexyl]phenyl]cyclohexyl] 2-fluoroheptanoate?
[4-[3-fluoro-4-[4-(2-fluoroheptanoyloxy)cyclohexyl]phenyl]cyclohexyl] 2-fluoroheptanoate has a molecular weight of 552.72 g/mol, XLogP of 8.80, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[3-fluoro-4-[4-(2-fluoroheptanoyloxy)cyclohexyl]phenyl]cyclohexyl] 2-fluoroheptanoate is sourced from PubChem (CID 18960164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).