C16H14N6O3 — CID 18960655
5-(3,4-dimethoxyphenyl)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine (PubChem CID 18960655) has the molecular formula C16H14N6O3 and a molecular weight of 338.33 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine.
| Compound Name | 5-(3,4-dimethoxyphenyl)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
|---|---|
| PubChem CID | 18960655 |
| Molecular Formula | C16H14N6O3 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
| SMILES | COc1ccc(-c2nc(N)n3nc(-c4ccco4)nc3n2)cc1OC |
| InChI | InChI=1S/C16H14N6O3/c1-23-10-6-5-9(8-12(10)24-2)13-18-15(17)22-16(19-13)20-14(21-22)11-4-3-7-25-11/h3-8H,1-2H3,(H2,17,18,19,20,21) |
| InChIKey | OQXHEFRBIHDCGE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 113.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |