About 1-amino-2,3-diethylguanidine
1-amino-2,3-diethylguanidine (PubChem CID 18960692) has the molecular formula C5H14N4
and a molecular weight of 130.19 g/mol. Its IUPAC name is 1-amino-2,3-diethylguanidine.
Molecular Properties
| Compound Name | 1-amino-2,3-diethylguanidine |
| PubChem CID | 18960692 |
| Molecular Formula | C5H14N4 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.12 |
| IUPAC Name | 1-amino-2,3-diethylguanidine |
| SMILES | CC/N=C(\NN)NCC |
| InChI | InChI=1S/C5H14N4/c1-3-7-5(9-6)8-4-2/h3-4,6H2,1-2H3,(H2,7,8,9) |
| InChIKey | MODIVSAZZODFNO-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-2,3-diethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-2,3-diethylguanidine?
The IUPAC name of 1-amino-2,3-diethylguanidine (CID 18960692) is 1-amino-2,3-diethylguanidine.
What is the SMILES notation for 1-amino-2,3-diethylguanidine?
The canonical SMILES for 1-amino-2,3-diethylguanidine is CC/N=C(\NN)NCC.
What is the InChIKey of 1-amino-2,3-diethylguanidine?
The InChIKey is MODIVSAZZODFNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14N4/c1-3-7-5(9-6)8-4-2/h3-4,6H2,1-2H3,(H2,7,8,9).
What are the key properties of 1-amino-2,3-diethylguanidine?
1-amino-2,3-diethylguanidine has a molecular weight of 130.19 g/mol, XLogP of -0.56, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-2,3-diethylguanidine is sourced from PubChem (CID 18960692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).