About 1-piperidin-4-yl-3,4-dihydroquinoline-2-thione
1-piperidin-4-yl-3,4-dihydroquinoline-2-thione (PubChem CID 18960737) has the molecular formula C14H18N2S
and a molecular weight of 246.38 g/mol. Its IUPAC name is 1-piperidin-4-yl-3,4-dihydroquinoline-2-thione.
Molecular Properties
| Compound Name | 1-piperidin-4-yl-3,4-dihydroquinoline-2-thione |
| PubChem CID | 18960737 |
| Molecular Formula | C14H18N2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 1-piperidin-4-yl-3,4-dihydroquinoline-2-thione |
| SMILES | S=C1CCc2ccccc2N1C1CCNCC1 |
| InChI | InChI=1S/C14H18N2S/c17-14-6-5-11-3-1-2-4-13(11)16(14)12-7-9-15-10-8-12/h1-4,12,15H,5-10H2 |
| InChIKey | UEVYXLYNEMDRBT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-piperidin-4-yl-3,4-dihydroquinoline-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-piperidin-4-yl-3,4-dihydroquinoline-2-thione?
The IUPAC name of 1-piperidin-4-yl-3,4-dihydroquinoline-2-thione (CID 18960737) is 1-piperidin-4-yl-3,4-dihydroquinoline-2-thione.
What is the SMILES notation for 1-piperidin-4-yl-3,4-dihydroquinoline-2-thione?
The canonical SMILES for 1-piperidin-4-yl-3,4-dihydroquinoline-2-thione is S=C1CCc2ccccc2N1C1CCNCC1.
What is the InChIKey of 1-piperidin-4-yl-3,4-dihydroquinoline-2-thione?
The InChIKey is UEVYXLYNEMDRBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2S/c17-14-6-5-11-3-1-2-4-13(11)16(14)12-7-9-15-10-8-12/h1-4,12,15H,5-10H2.
What are the key properties of 1-piperidin-4-yl-3,4-dihydroquinoline-2-thione?
1-piperidin-4-yl-3,4-dihydroquinoline-2-thione has a molecular weight of 246.38 g/mol, XLogP of 2.52, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-piperidin-4-yl-3,4-dihydroquinoline-2-thione is sourced from PubChem (CID 18960737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).