C14H21N3O6 — CID 18960891
3-(2-ethoxyethyl)-5-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,4-oxadiazole;oxalic acid (PubChem CID 18960891) has the molecular formula C14H21N3O6 and a molecular weight of 327.34 g/mol. Its IUPAC name is 3-(2-ethoxyethyl)-5-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,4-oxadiazole;oxalic acid.
| Compound Name | 3-(2-ethoxyethyl)-5-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,4-oxadiazole;oxalic acid |
|---|---|
| PubChem CID | 18960891 |
| Molecular Formula | C14H21N3O6 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 3-(2-ethoxyethyl)-5-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,4-oxadiazole;oxalic acid |
| SMILES | CCOCCc1noc(C2=CCCN(C)C2)n1.O=C(O)C(=O)O |
| InChI | InChI=1S/C12H19N3O2.C2H2O4/c1-3-16-8-6-11-13-12(17-14-11)10-5-4-7-15(2)9-10;3-1(4)2(5)6/h5H,3-4,6-9H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | MRSYDORXKMPVHW-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|