C15H21N3O5 — CID 18960931
5-(8-methyl-8-azabicyclo[3.2.1]oct-2-en-2-yl)-3-propan-2-yl-1,2,4-oxadiazole;oxalic acid (PubChem CID 18960931) has the molecular formula C15H21N3O5 and a molecular weight of 323.35 g/mol. Its IUPAC name is 5-(8-methyl-8-azabicyclo[3.2.1]oct-2-en-2-yl)-3-propan-2-yl-1,2,4-oxadiazole;oxalic acid.
| Compound Name | 5-(8-methyl-8-azabicyclo[3.2.1]oct-2-en-2-yl)-3-propan-2-yl-1,2,4-oxadiazole;oxalic acid |
|---|---|
| PubChem CID | 18960931 |
| Molecular Formula | C15H21N3O5 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 5-(8-methyl-8-azabicyclo[3.2.1]oct-2-en-2-yl)-3-propan-2-yl-1,2,4-oxadiazole;oxalic acid |
| SMILES | CC(C)c1noc(C2=CCC3CCC2N3C)n1.O=C(O)C(=O)O |
| InChI | InChI=1S/C13H19N3O.C2H2O4/c1-8(2)12-14-13(17-15-12)10-6-4-9-5-7-11(10)16(9)3;3-1(4)2(5)6/h6,8-9,11H,4-5,7H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | IXVMDSZPKBNQDG-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|