C8H11N3O — CID 18960961
(5Z)-N-methoxy-1,2,3,6-tetrahydropyridine-5-carboximidoyl cyanide (PubChem CID 18960961) has the molecular formula C8H11N3O and a molecular weight of 165.20 g/mol. Its IUPAC name is (5Z)-N-methoxy-1,2,3,6-tetrahydropyridine-5-carboximidoyl cyanide.
| Compound Name | (5Z)-N-methoxy-1,2,3,6-tetrahydropyridine-5-carboximidoyl cyanide |
|---|---|
| PubChem CID | 18960961 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | (5Z)-N-methoxy-1,2,3,6-tetrahydropyridine-5-carboximidoyl cyanide |
| SMILES | CO/N=C(\C#N)C1=CCCNC1 |
| InChI | InChI=1S/C8H11N3O/c1-12-11-8(5-9)7-3-2-4-10-6-7/h3,10H,2,4,6H2,1H3/b11-8+ |
| InChIKey | VMMDRBODBOIPTK-DHZHZOJOSA-N |
| XLogP | 0.43 |
| TPSA | 57.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|