C8H3F11 — CID 18961385
1-ethenyl-1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane (PubChem CID 18961385) has the molecular formula C8H3F11 and a molecular weight of 308.09 g/mol. Its IUPAC name is 1-ethenyl-1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane.
| Compound Name | 1-ethenyl-1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane |
|---|---|
| PubChem CID | 18961385 |
| Molecular Formula | C8H3F11 |
| Molecular Weight | 308.09 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | 1-ethenyl-1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane |
| SMILES | C=CC1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C8H3F11/c1-2-3(9)4(10,11)6(14,15)8(18,19)7(16,17)5(3,12)13/h2H,1H2 |
| InChIKey | PQVNXVLRJPDISV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.09 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|