About 4-carbamoyl-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid
4-carbamoyl-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid (PubChem CID 18961669) has the molecular formula C22H13NO8
and a molecular weight of 419.35 g/mol. Its IUPAC name is 4-carbamoyl-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid.
Molecular Properties
| Compound Name | 4-carbamoyl-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid |
| PubChem CID | 18961669 |
| Molecular Formula | C22H13NO8 |
| Molecular Weight | 419.35 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | 4-carbamoyl-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid |
| SMILES | NC(=O)c1c(C(=O)O)ccc2c1C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21 |
| InChI | InChI=1S/C22H13NO8/c23-19(26)17-11(20(27)28)3-6-14-18(17)21(29)31-22(14)12-4-1-9(24)7-15(12)30-16-8-10(25)2-5-13(16)22/h1-8,24-25H,(H2,23,26)(H,27,28) |
| InChIKey | PUQBAPMIBDISRR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 156.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-carbamoyl-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-carbamoyl-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid?
The IUPAC name of 4-carbamoyl-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid (CID 18961669) is 4-carbamoyl-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid.
What is the SMILES notation for 4-carbamoyl-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid?
The canonical SMILES for 4-carbamoyl-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid is NC(=O)c1c(C(=O)O)ccc2c1C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21.
What is the InChIKey of 4-carbamoyl-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid?
The InChIKey is PUQBAPMIBDISRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H13NO8/c23-19(26)17-11(20(27)28)3-6-14-18(17)21(29)31-22(14)12-4-1-9(24)7-15(12)30-16-8-10(25)2-5-13(16)22/h1-8,24-25H,(H2,23,26)(H,27,28).
What are the key properties of 4-carbamoyl-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid?
4-carbamoyl-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid has a molecular weight of 419.35 g/mol, XLogP of 2.46, 2 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-carbamoyl-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid is sourced from PubChem (CID 18961669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).