About 4,5-dihydroimidazol-1-yl benzoate
4,5-dihydroimidazol-1-yl benzoate (PubChem CID 18961684) has the molecular formula C10H10N2O2
and a molecular weight of 190.20 g/mol. Its IUPAC name is 4,5-dihydroimidazol-1-yl benzoate.
Molecular Properties
| Compound Name | 4,5-dihydroimidazol-1-yl benzoate |
| PubChem CID | 18961684 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 4,5-dihydroimidazol-1-yl benzoate |
| SMILES | O=C(ON1C=NCC1)c1ccccc1 |
| InChI | InChI=1S/C10H10N2O2/c13-10(9-4-2-1-3-5-9)14-12-7-6-11-8-12/h1-5,8H,6-7H2 |
| InChIKey | QWKWVHKVAFMGCQ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,5-dihydroimidazol-1-yl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydroimidazol-1-yl benzoate?
The IUPAC name of 4,5-dihydroimidazol-1-yl benzoate (CID 18961684) is 4,5-dihydroimidazol-1-yl benzoate.
What is the SMILES notation for 4,5-dihydroimidazol-1-yl benzoate?
The canonical SMILES for 4,5-dihydroimidazol-1-yl benzoate is O=C(ON1C=NCC1)c1ccccc1.
What is the InChIKey of 4,5-dihydroimidazol-1-yl benzoate?
The InChIKey is QWKWVHKVAFMGCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2/c13-10(9-4-2-1-3-5-9)14-12-7-6-11-8-12/h1-5,8H,6-7H2.
What are the key properties of 4,5-dihydroimidazol-1-yl benzoate?
4,5-dihydroimidazol-1-yl benzoate has a molecular weight of 190.20 g/mol, XLogP of 1.10, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydroimidazol-1-yl benzoate is sourced from PubChem (CID 18961684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).